(2,2′-Bipyridine)bis[2-(2,4-difluorophenyl)pyridine]iridium(III) Hexafluorophosphate

CAS#: 864163-80-4
Molecular Weight: 873.71
Molecular Formula: C32H20F10IrN4P
Purity%:  >98
SMILES: c1ccnc(c1)c2ccccn2.c1ccnc(c1) c2c(cc(cc2[Ir+]c3cc(cc(c3c4ccccn4) F)F)F)F.F[P-](F)(F)(F)(F)F

Clear