24R)-24,25-DIHYDROXYVITAMIN D3, >=98%

CAS#: 55721-11-4
Molecular Weight: 416.64
Molecular Formula: C27H44O3
Purity%:
SMILES: C[C@H](CC[C@H](C(C)(C)O)O)[C@H]1CC[C@H]\2[C@@]1(CCC/C2=C\C=C/3\C[C@H](CCC3=C)O)C

Clear
SKU: HET170006 Category: