3,5-Dimethyl-1H-pyrazole-4-sulfonyl chloride

CAS#: 80466-78-0
Molecular Weight: 194.64
Molecular Formula: C5H7ClN2O2S
Purity%: >97
SMILES: Cc1c(c(n[nH]1)C)S(=O)(=O)Cl

Clear
SKU: HET7141 Categories: ,