ALBENDAZOLE

CAS#: 54965-21-8
Molecular Weight: 265.33
Molecular Formula: C12H15N3O2S
Purity%:
SMILES: CCCSc1ccc2c(c1)nc([nH]2)NC(=O)OC

Clear
SKU: HET170000 Category: