Alpelisib

CAS#: 1217486-47-9
Molecular Weight: 441.47
Molecular Formula: C19H22F3N5O2S
Purity%:
SMILES: Cc1c(sc(n1)NC(=O)N2CCC[C@H]2C(=O)N)c3ccnc(c3)C(C)(C)C(F)(F)F

Clear
SKU: HET170010 Category: