C 545T/ 10-(1,3-Benzothiazol-2-yl)-1,1,7,7-tetramethyl-2,3,6,7-tetrahydro-1H,5H,11H-pyrano[2,3-f]pyrido[3,2,1-ij]quinolin-11-one

CAS#: 155306-71-1
Molecular Weight: 430.56
Molecular Formula: C26H26N2O2S
Purity%:  >98
SMILES: CC1(CCN2CCC(c3c2c1cc4c3oc(=O)c(c4)c5nc6ccccc6s5)(C)C)C

Clear