CHOLESTERYL-TEG AZIDE

CAS#: 1391826-58-6
Molecular Weight: 630.9
Molecular Formula: C36H62N4O5
Purity%:
SMILES: C[C@H](CCCC(C)C)[C@H]1CC[C@@H]2[C@@]1 (CC[C@H]3[C@H]2CC=C4[C@@]3(CC[C@@H] (C4)OC(=O)NCCOCCOCCOCCN=[N+]=[N-])C)C

Clear
SKU: HET170002 Category: