DMAC-DPS/10,10′-(4,4′-Sulfonylbis(4,1-phenylene))bis(9,9-dimethyl-9,10-dihydroacridine

CAS#: 1477512-32-5
Molecular Weight: 632.81
Molecular Formula: C42H36N2O2S
Purity%:  >98
SMILES: CC1(c2ccccc2N(c3c1cccc3)c4ccc(cc4)S(=O)(=O)c5ccc(cc5)N6c7ccccc7C(c8c6cccc8)(C)C)C

Clear