DNTPD/N,N’-Bis[4-di(m-tolyl)aminophenyl]-N,N’-diphenylbenzidine

CAS#: 199121-98-7
Molecular Weight: 879.14
Molecular Formula: C64H54N4
Purity%:  >98
SMILES: Cc1cc(ccc1)N(c2cc(C)ccc2)c3ccc (cc3)N(c4ccccc4)c5ccc(cc5)c6ccc (cc6)N(c7ccccc7)c8ccc(cc8) N(c9cccc(C)c9)c%10cc(C)ccc%10

Clear