Duvelisib

CAS#: 1386861-49-9
Molecular Weight: 434.88
Molecular Formula: C22H19ClN6O2
Purity%:
SMILES: O.C[C@H](NC1N=CN=C2NC=NC2=1) C1=CC2C=CC=C(Cl)C=2C(=O)N1C1C=CC=CC=1

Clear
SKU: HET170024 Category: