Entrectinib

CAS#: 1108743-60-7
Molecular Weight: 560.64
Molecular Formula: C31H34F2N6O2
Purity%:
SMILES: CN1CCN(CC1)c2ccc(c(c2)NC3CCOCC3) C(=O)Nc4c5cc(ccc5[nH]n4)Cc6cc(cc(c6)F)F

Clear
SKU: HET170022 Category: