PBD/2-(4-tert-Butylphenyl)-5-(4-biphenylyl)-1,3,4-oxadiazole

CAS#: 15082-28-7
Molecular Weight: 354.44
Molecular Formula: C24H22N2O
Purity%:  >98
SMILES: CC(C)(C)c1ccc(cc1)c2nnc(o2)c3ccc(cc3)c4ccccc4

Clear