Pexidartinib

CAS#: 1029044-16-3
Molecular Weight: 417.81
Molecular Formula: C20H15ClF3N5
Purity%:
SMILES: c1cc(ncc1Cc2c[nH]c3c2cc(cn3)Cl)NCc4ccc(nc4)C(F)(F)F

Clear
SKU: HET170020 Category: