PINDOLOL

CAS#: 13523-86-9
Molecular Weight: 248.32
Molecular Formula: C14H20N2O2
Purity%:
SMILES: CC(C)NCC(COc1cccc2c1cc[nH]2)O

Clear
SKU: HET170001 Category: