PODOPHYLLOTOXIN APPROX. 98%

CAS#: 518-28-5
Molecular Weight: 414.41
Molecular Formula: C22H22O8
Purity%:
SMILES: COc1cc(cc(c1OC)OC)[C@@H]2c3cc4c(cc3[C@@H]([C@@H]5[C@@H]2C(=O)OC5)O)OCO4

Clear
SKU: HET170005 Category: