(S)-TERT-BUTYL 1-(CHLOROMETHYL)-5-HYDROXY-1H-BENZO[E]INDOLE-3(2H)-CARBOXYLATE

CAS#: 130007-86-2
Molecular Weight: 333.81
Molecular Formula:C18H20ClNO3
Purity%:
SMILES: CC(C)(C)OC(=O)N1C[C@H](c2c1cc(c3c2cccc3)O)CCl

Clear
SKU: HET170003 Category: