Selumetinib

CAS#: 606143-52-6
Molecular Weight: 457.68
Molecular Formula: C17H15BrClFN4O3
Purity%:
SMILES: Cn1cnc2c1cc(c(c2F)Nc3ccc(cc3Cl)Br)C(=O)NOCCO

Clear
SKU: HET170017 Category: