Talazoparib

CAS#: 1207456-01-6
Molecular Weight: 380.35
Molecular Formula: C19H14F2N6O
Purity%:
SMILES: Cn1c(ncn1)[C@H]2c3c4c(cc(cc4N[C@@H]2c5ccc(cc5)F)F)c(=O)[nH]n3

Clear
SKU: HET170015 Category: