TaTm/N,N,N’,N’-Tetra([1,1′-biphenyl]-4-yl)[1,1′:4′,1”-terphenyl]-4,4”-diamine

CAS#: 952431-34-4
Molecular Weight: 869.1
Molecular Formula: C66H48N2
Purity%:  >98
SMILES: C1=CC(=CC=C1C1C=CC(=CC=1) N(C1C=CC(=CC=1)C1C=CC=CC=1) C1C=CC(=CC=1)C1C=CC=CC=1)C1C=CC(=CC=1) N(C1C=CC(=CC=1)C1C=CC=CC=1) C1C=CC(=CC=1)C1C=CC=CC=1

Clear