TSPO1/Diphenyl-4-triphenylsilylphenyl-phosphine oxide

CAS#: 1286708-86-8
Molecular Weight: 536.67
Molecular Formula: C36H29OPSi
Purity%:  >98
SMILES: c1ccc(cc1)[Si](c2ccccc2)(c3ccccc3)c4ccc(cc4)P(=O)(c5ccccc5)c6ccccc6

Clear