TTPA/9,10-Bis[N,N-di-(p-tolyl)-amino]anthracene

CAS#: 177799-16-5
Molecular Weight: 568.75
Molecular Formula: C42H36N2
Purity%:  >98
SMILES: Cc1ccc(cc1)N(c2ccc (cc2)C)c3c4ccccc4c(c5c3cccc5) N(c6ccc(cc6)C)c7ccc(cc7)C

Clear