Tucatinib

CAS#: 937263-43-9
Molecular Weight: 480.52
Molecular Formula: C26H24N8O2
Purity%:
SMILES: Cc1cc(ccc1Oc2ccn3c(c2)ncn3) Nc4c5cc(ccc5ncn4)NC6=NC(CO6)(C)C

Clear
SKU: HET170009 Category: