Venetoclax (ABT-199)

CAS#: 1257044-40-8
Molecular Weight: 868.44
Molecular Formula: C45H50ClN7O7S
Purity%:
SMILES: CC1(CCC(=C(C1)c2ccc(cc2)Cl)CN3CCN(CC3) c4ccc(c(c4)Oc5cc6cc[nH]c6nc5)C(=O)NS (=O)(=O)c7ccc(c(c7)[N+](=O)[O-])NCC8CCOCC8)C

Clear
SKU: HET170014 Category: